C16H10FN5O2 — CID 136929754
2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-6-nitro-1H-benzimidazole (PubChem CID 136929754) has the molecular formula C16H10FN5O2 and a molecular weight of 323.29 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-6-nitro-1H-benzimidazole.
| Compound Name | 2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-6-nitro-1H-benzimidazole |
|---|---|
| PubChem CID | 136929754 |
| Molecular Formula | C16H10FN5O2 |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-6-nitro-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3cc(-c4ccc(F)cc4)n[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C16H10FN5O2/c17-10-3-1-9(2-4-10)13-8-15(21-20-13)16-18-12-6-5-11(22(23)24)7-14(12)19-16/h1-8H,(H,18,19)(H,20,21) |
| InChIKey | WIFDXGDWOLMSJJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|