About 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole
6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole (PubChem CID 136929765) has the molecular formula C19H17FN4O3
and a molecular weight of 368.37 g/mol. Its IUPAC name is 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole |
| PubChem CID | 136929765 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole |
| SMILES | COc1cc(-c2cc(-c3nc4ccc(F)cc4[nH]3)[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17FN4O3/c1-25-16-6-10(7-17(26-2)18(16)27-3)13-9-15(24-23-13)19-21-12-5-4-11(20)8-14(12)22-19/h4-9H,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | AWWHFLRMXILONY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole?
The IUPAC name of 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole (CID 136929765) is 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole.
What is the SMILES notation for 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole?
The canonical SMILES for 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole is COc1cc(-c2cc(-c3nc4ccc(F)cc4[nH]3)[nH]n2)cc(OC)c1OC.
What is the InChIKey of 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole?
The InChIKey is AWWHFLRMXILONY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN4O3/c1-25-16-6-10(7-17(26-2)18(16)27-3)13-9-15(24-23-13)19-21-12-5-4-11(20)8-14(12)22-19/h4-9H,1-3H3,(H,21,22)(H,23,24).
What are the key properties of 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole?
6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole has a molecular weight of 368.37 g/mol, XLogP of 3.78, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]-1H-benzimidazole is sourced from PubChem (CID 136929765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).