C54H54N4O10 — CID 136930181
[2-ethyl-2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxymethyl]butyl] 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate (PubChem CID 136930181) has the molecular formula C54H54N4O10 and a molecular weight of 919.04 g/mol. Its IUPAC name is [2-ethyl-2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxymethyl]butyl] 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate.
| Compound Name | [2-ethyl-2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxymethyl]butyl] 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
|---|---|
| PubChem CID | 136930181 |
| Molecular Formula | C54H54N4O10 |
| Molecular Weight | 919.04 g/mol |
| Exact Mass | 918.38 |
| IUPAC Name | [2-ethyl-2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxymethyl]butyl] 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)OCC(CC)(CC)COC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C54H54N4O10/c1-7-46(60)64-32-53(6,33-65-47(61)8-2)58-52(63)67-35-54(9-3,10-4)34-66-51(62)36(5)68-43-29-30-44(45(59)31-43)50-56-48(41-25-21-39(22-26-41)37-17-13-11-14-18-37)55-49(57-50)42-27-23-40(24-28-42)38-19-15-12-16-20-38/h7-8,11-31,36,59H,1-2,9-10,32-35H2,3-6H3,(H,58,63) |
| InChIKey | DACXKXYVXALALS-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 185.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.04 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|