C13H24N2OS2 — CID 136930287
7-methyl-N-(3-methylsulfinylpropyl)-3-thia-1-azaspiro[4.5]decan-2-imine (PubChem CID 136930287) has the molecular formula C13H24N2OS2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 7-methyl-N-(3-methylsulfinylpropyl)-3-thia-1-azaspiro[4.5]decan-2-imine.
| Compound Name | 7-methyl-N-(3-methylsulfinylpropyl)-3-thia-1-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 136930287 |
| Molecular Formula | C13H24N2OS2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 7-methyl-N-(3-methylsulfinylpropyl)-3-thia-1-azaspiro[4.5]decan-2-imine |
| SMILES | CC1CCCC2(CS/C(=N\CCCS(C)=O)N2)C1 |
| InChI | InChI=1S/C13H24N2OS2/c1-11-5-3-6-13(9-11)10-17-12(15-13)14-7-4-8-18(2)16/h11H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | UIMFWWBKUHRYEU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|