C8H11F3N6O — CID 136930668
1-(4-carbamimidoyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 136930668) has the molecular formula C8H11F3N6O and a molecular weight of 264.21 g/mol. Its IUPAC name is 1-(4-carbamimidoyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-carbamimidoyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 136930668 |
| Molecular Formula | C8H11F3N6O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-(4-carbamimidoyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | [H]/N=C(\N)c1cnn(C)c1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N6O/c1-17-6(4(2-15-17)5(12)13)16-7(18)14-3-8(9,10)11/h2H,3H2,1H3,(H3,12,13)(H2,14,16,18) |
| InChIKey | GZNNLVBGYUPUHE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|