About 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol
4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol (PubChem CID 136931065) has the molecular formula C11H11BrN2O2
and a molecular weight of 283.12 g/mol. Its IUPAC name is 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol |
| PubChem CID | 136931065 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol |
| SMILES | Cc1cc(O)c(Br)c(C)c1-c1cc(N)on1 |
| InChI | InChI=1S/C11H11BrN2O2/c1-5-3-8(15)11(12)6(2)10(5)7-4-9(13)16-14-7/h3-4,15H,13H2,1-2H3 |
| InChIKey | PETYBANQTGBDCH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol?
The IUPAC name of 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol (CID 136931065) is 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol.
What is the SMILES notation for 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol?
The canonical SMILES for 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol is Cc1cc(O)c(Br)c(C)c1-c1cc(N)on1.
What is the InChIKey of 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol?
The InChIKey is PETYBANQTGBDCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O2/c1-5-3-8(15)11(12)6(2)10(5)7-4-9(13)16-14-7/h3-4,15H,13H2,1-2H3.
What are the key properties of 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol?
4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol has a molecular weight of 283.12 g/mol, XLogP of 3.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-1,2-oxazol-3-yl)-2-bromo-3,5-dimethylphenol is sourced from PubChem (CID 136931065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).