C10H10BrN3O2 — CID 136931137
3-(5-amino-1-methylpyrazol-3-yl)-5-bromobenzene-1,2-diol (PubChem CID 136931137) has the molecular formula C10H10BrN3O2 and a molecular weight of 284.11 g/mol. Its IUPAC name is 3-(5-amino-1-methylpyrazol-3-yl)-5-bromobenzene-1,2-diol.
| Compound Name | 3-(5-amino-1-methylpyrazol-3-yl)-5-bromobenzene-1,2-diol |
|---|---|
| PubChem CID | 136931137 |
| Molecular Formula | C10H10BrN3O2 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3-(5-amino-1-methylpyrazol-3-yl)-5-bromobenzene-1,2-diol |
| SMILES | Cn1nc(-c2cc(Br)cc(O)c2O)cc1N |
| InChI | InChI=1S/C10H10BrN3O2/c1-14-9(12)4-7(13-14)6-2-5(11)3-8(15)10(6)16/h2-4,15-16H,12H2,1H3 |
| InChIKey | PINGSIDRYNACDC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|