C25H28N6O2S — CID 136931601
5-aminooxy-2-[4-[4-[(dimethylamino)methyl]phenyl]-5-pyridin-2-ylsulfanyl-1,2,4-triazol-3-yl]-4-propan-2-ylphenol (PubChem CID 136931601) has the molecular formula C25H28N6O2S and a molecular weight of 476.61 g/mol. Its IUPAC name is 5-aminooxy-2-[4-[4-[(dimethylamino)methyl]phenyl]-5-pyridin-2-ylsulfanyl-1,2,4-triazol-3-yl]-4-propan-2-ylphenol.
| Compound Name | 5-aminooxy-2-[4-[4-[(dimethylamino)methyl]phenyl]-5-pyridin-2-ylsulfanyl-1,2,4-triazol-3-yl]-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 136931601 |
| Molecular Formula | C25H28N6O2S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 5-aminooxy-2-[4-[4-[(dimethylamino)methyl]phenyl]-5-pyridin-2-ylsulfanyl-1,2,4-triazol-3-yl]-4-propan-2-ylphenol |
| SMILES | CC(C)c1cc(-c2nnc(Sc3ccccn3)n2-c2ccc(CN(C)C)cc2)c(O)cc1ON |
| InChI | InChI=1S/C25H28N6O2S/c1-16(2)19-13-20(21(32)14-22(19)33-26)24-28-29-25(34-23-7-5-6-12-27-23)31(24)18-10-8-17(9-11-18)15-30(3)4/h5-14,16,32H,15,26H2,1-4H3 |
| InChIKey | YQTJKAALZCKXEU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|