C26H26N4O5 — CID 136931650
5-[3-[(2Z)-2-[1-[(2,2-dimethyl-1,3-dihydroinden-5-yl)amino]-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid (PubChem CID 136931650) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is 5-[3-[(2Z)-2-[1-[(2,2-dimethyl-1,3-dihydroinden-5-yl)amino]-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-[(2Z)-2-[1-[(2,2-dimethyl-1,3-dihydroinden-5-yl)amino]-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 136931650 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 5-[3-[(2Z)-2-[1-[(2,2-dimethyl-1,3-dihydroinden-5-yl)amino]-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid |
| SMILES | [H]/N=C(C)/C(=N/Nc1cccc(-c2ccc(C(=O)O)o2)c1O)C(=O)Nc1ccc2c(c1)CC(C)(C)C2 |
| InChI | InChI=1S/C26H26N4O5/c1-14(27)22(24(32)28-17-8-7-15-12-26(2,3)13-16(15)11-17)30-29-19-6-4-5-18(23(19)31)20-9-10-21(35-20)25(33)34/h4-11,27,29,31H,12-13H2,1-3H3,(H,28,32)(H,33,34)/b27-14+,30-22- |
| InChIKey | CJUBEQPRDMLZOC-MTUKAXGZSA-N |
| XLogP | 4.92 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|