C11H13ClN4O — CID 136932082
2-(5-chloro-1-methylimidazol-2-yl)-4-ethyl-5-methyl-1H-pyrimidin-6-one (PubChem CID 136932082) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-(5-chloro-1-methylimidazol-2-yl)-4-ethyl-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(5-chloro-1-methylimidazol-2-yl)-4-ethyl-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136932082 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-(5-chloro-1-methylimidazol-2-yl)-4-ethyl-5-methyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(-c2ncc(Cl)n2C)[nH]c(=O)c1C |
| InChI | InChI=1S/C11H13ClN4O/c1-4-7-6(2)11(17)15-9(14-7)10-13-5-8(12)16(10)3/h5H,4H2,1-3H3,(H,14,15,17) |
| InChIKey | IEEHOAZKIZYEJV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |