About 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136932117) has the molecular formula C9H13F2N3O3
and a molecular weight of 249.22 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one |
| PubChem CID | 136932117 |
| Molecular Formula | C9H13F2N3O3 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(N(CCO)CC(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C9H13F2N3O3/c1-17-7-8(12-5-13-9(7)16)14(2-3-15)4-6(10)11/h5-6,15H,2-4H2,1H3,(H,12,13,16) |
| InChIKey | ILPOAQGATLGDIV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one?
The IUPAC name of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one (CID 136932117) is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one?
The canonical SMILES for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one is COc1c(N(CCO)CC(F)F)nc[nH]c1=O.
What is the InChIKey of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one?
The InChIKey is ILPOAQGATLGDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O3/c1-17-7-8(12-5-13-9(7)16)14(2-3-15)4-6(10)11/h5-6,15H,2-4H2,1H3,(H,12,13,16).
What are the key properties of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one?
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one has a molecular weight of 249.22 g/mol, XLogP of -0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-methoxy-1H-pyrimidin-6-one is sourced from PubChem (CID 136932117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).