About 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid
3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 136932522) has the molecular formula C10H5ClF2N2O3
and a molecular weight of 274.61 g/mol. Its IUPAC name is 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 136932522 |
| Molecular Formula | C10H5ClF2N2O3 |
| Molecular Weight | 274.61 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(Cl)c(O)c(F)c2F)n[nH]1 |
| InChI | InChI=1S/C10H5ClF2N2O3/c11-4-1-3(7(12)8(13)9(4)16)5-2-6(10(17)18)15-14-5/h1-2,16H,(H,14,15)(H,17,18) |
| InChIKey | DHKYEEFSQUTAGX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid (CID 136932522) is 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid is O=C(O)c1cc(-c2cc(Cl)c(O)c(F)c2F)n[nH]1.
What is the InChIKey of 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid?
The InChIKey is DHKYEEFSQUTAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClF2N2O3/c11-4-1-3(7(12)8(13)9(4)16)5-2-6(10(17)18)15-14-5/h1-2,16H,(H,14,15)(H,17,18).
What are the key properties of 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid?
3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid has a molecular weight of 274.61 g/mol, XLogP of 2.41, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2,3-difluoro-4-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 136932522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).