C17H19FN6O — CID 136932894
10-(2-fluoroethyl)-7-oxa-3,10,13,18,20,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(19),2,4,6(22),14(21),15,17-heptaene (PubChem CID 136932894) has the molecular formula C17H19FN6O and a molecular weight of 342.38 g/mol. Its IUPAC name is 10-(2-fluoroethyl)-7-oxa-3,10,13,18,20,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(19),2,4,6(22),14(21),15,17-heptaene.
| Compound Name | 10-(2-fluoroethyl)-7-oxa-3,10,13,18,20,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(19),2,4,6(22),14(21),15,17-heptaene |
|---|---|
| PubChem CID | 136932894 |
| Molecular Formula | C17H19FN6O |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 10-(2-fluoroethyl)-7-oxa-3,10,13,18,20,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(19),2,4,6(22),14(21),15,17-heptaene |
| SMILES | FCCN1CCNc2ccc3ncc(n3n2)-c2cc(ccn2)OCC1 |
| InChI | InChI=1S/C17H19FN6O/c18-4-7-23-8-6-20-16-1-2-17-21-12-15(24(17)22-16)14-11-13(3-5-19-14)25-10-9-23/h1-3,5,11-12H,4,6-10H2,(H,20,22) |
| InChIKey | JBVHMNZTWSDRMR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |