C22H21F2N5O3S — CID 136933087
8-[3-[(1S,2R,5R)-4-amino-2,5-dimethyl-8,8-dioxo-8λ6-thia-3-azabicyclo[3.2.1]oct-3-en-2-yl]-4-fluoroanilino]-5-fluoro-1,7-naphthyridin-3-ol (PubChem CID 136933087) has the molecular formula C22H21F2N5O3S and a molecular weight of 473.51 g/mol. Its IUPAC name is 8-[3-[(1S,2R,5R)-4-amino-2,5-dimethyl-8,8-dioxo-8λ6-thia-3-azabicyclo[3.2.1]oct-3-en-2-yl]-4-fluoroanilino]-5-fluoro-1,7-naphthyridin-3-ol.
| Compound Name | 8-[3-[(1S,2R,5R)-4-amino-2,5-dimethyl-8,8-dioxo-8λ6-thia-3-azabicyclo[3.2.1]oct-3-en-2-yl]-4-fluoroanilino]-5-fluoro-1,7-naphthyridin-3-ol |
|---|---|
| PubChem CID | 136933087 |
| Molecular Formula | C22H21F2N5O3S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 8-[3-[(1S,2R,5R)-4-amino-2,5-dimethyl-8,8-dioxo-8λ6-thia-3-azabicyclo[3.2.1]oct-3-en-2-yl]-4-fluoroanilino]-5-fluoro-1,7-naphthyridin-3-ol |
| SMILES | C[C@]1(c2cc(Nc3ncc(F)c4cc(O)cnc34)ccc2F)N=C(N)[C@@]2(C)CC[C@@H]1S2(=O)=O |
| InChI | InChI=1S/C22H21F2N5O3S/c1-21-6-5-17(33(21,31)32)22(2,29-20(21)25)14-7-11(3-4-15(14)23)28-19-18-13(16(24)10-27-19)8-12(30)9-26-18/h3-4,7-10,17,30H,5-6H2,1-2H3,(H2,25,29)(H,27,28)/t17-,21+,22+/m0/s1 |
| InChIKey | LHBKEQZLDGTNKW-MTNREXPMSA-N |
| XLogP | 3.28 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |