About 4-(3-methylpent-2-enyl)phenazine-1,6-diol
4-(3-methylpent-2-enyl)phenazine-1,6-diol (PubChem CID 136933100) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-(3-methylpent-2-enyl)phenazine-1,6-diol.
Molecular Properties
| Compound Name | 4-(3-methylpent-2-enyl)phenazine-1,6-diol |
| PubChem CID | 136933100 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-(3-methylpent-2-enyl)phenazine-1,6-diol |
| SMILES | CCC(C)=CCc1ccc(O)c2nc3cccc(O)c3nc12 |
| InChI | InChI=1S/C18H18N2O2/c1-3-11(2)7-8-12-9-10-15(22)18-16(12)20-17-13(19-18)5-4-6-14(17)21/h4-7,9-10,21-22H,3,8H2,1-2H3 |
| InChIKey | CJCURMLHWBHRPN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylpent-2-enyl)phenazine-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylpent-2-enyl)phenazine-1,6-diol?
The IUPAC name of 4-(3-methylpent-2-enyl)phenazine-1,6-diol (CID 136933100) is 4-(3-methylpent-2-enyl)phenazine-1,6-diol.
What is the SMILES notation for 4-(3-methylpent-2-enyl)phenazine-1,6-diol?
The canonical SMILES for 4-(3-methylpent-2-enyl)phenazine-1,6-diol is CCC(C)=CCc1ccc(O)c2nc3cccc(O)c3nc12.
What is the InChIKey of 4-(3-methylpent-2-enyl)phenazine-1,6-diol?
The InChIKey is CJCURMLHWBHRPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-3-11(2)7-8-12-9-10-15(22)18-16(12)20-17-13(19-18)5-4-6-14(17)21/h4-7,9-10,21-22H,3,8H2,1-2H3.
What are the key properties of 4-(3-methylpent-2-enyl)phenazine-1,6-diol?
4-(3-methylpent-2-enyl)phenazine-1,6-diol has a molecular weight of 294.35 g/mol, XLogP of 4.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylpent-2-enyl)phenazine-1,6-diol is sourced from PubChem (CID 136933100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).