About N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine
N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine (PubChem CID 136933197) has the molecular formula C14H26N2S
and a molecular weight of 254.44 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine.
Molecular Properties
| Compound Name | N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine |
| PubChem CID | 136933197 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine |
| SMILES | CCC1CCS/C(=N\C2CCCC(C)C2C)N1 |
| InChI | InChI=1S/C14H26N2S/c1-4-12-8-9-17-14(15-12)16-13-7-5-6-10(2)11(13)3/h10-13H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | HKHGXGVGKXYWTL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine?
The IUPAC name of N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine (CID 136933197) is N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine.
What is the SMILES notation for N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine?
The canonical SMILES for N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine is CCC1CCS/C(=N\C2CCCC(C)C2C)N1.
What is the InChIKey of N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine?
The InChIKey is HKHGXGVGKXYWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2S/c1-4-12-8-9-17-14(15-12)16-13-7-5-6-10(2)11(13)3/h10-13H,4-9H2,1-3H3,(H,15,16).
What are the key properties of N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine?
N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine has a molecular weight of 254.44 g/mol, XLogP of 3.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylcyclohexyl)-4-ethyl-1,3-thiazinan-2-imine is sourced from PubChem (CID 136933197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).