C42H52FN5O7S — CID 136933714
[2-[(5-tert-butylthiophen-3-yl)methyl-(2,2-dimethylpropyl)carbamoyl]quinolin-6-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-fluorobenzoate (PubChem CID 136933714) has the molecular formula C42H52FN5O7S and a molecular weight of 789.97 g/mol. Its IUPAC name is [2-[(5-tert-butylthiophen-3-yl)methyl-(2,2-dimethylpropyl)carbamoyl]quinolin-6-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-fluorobenzoate.
| Compound Name | [2-[(5-tert-butylthiophen-3-yl)methyl-(2,2-dimethylpropyl)carbamoyl]quinolin-6-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 136933714 |
| Molecular Formula | C42H52FN5O7S |
| Molecular Weight | 789.97 g/mol |
| Exact Mass | 789.36 |
| IUPAC Name | [2-[(5-tert-butylthiophen-3-yl)methyl-(2,2-dimethylpropyl)carbamoyl]quinolin-6-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-fluorobenzoate |
| SMILES | CC(C)(C)CN(Cc1csc(C(C)(C)C)c1)C(=O)c1ccc2cc(OC(=O)c3ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc3F)ccc2n1 |
| InChI | InChI=1S/C42H52FN5O7S/c1-39(2,3)24-48(22-25-19-33(56-23-25)40(4,5)6)34(49)32-17-13-26-20-28(15-18-31(26)45-32)53-35(50)29-16-14-27(21-30(29)43)44-36(46-37(51)54-41(7,8)9)47-38(52)55-42(10,11)12/h13-21,23H,22,24H2,1-12H3,(H2,44,46,47,51,52) |
| InChIKey | BDBKAAIPFPIGRS-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.97 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|