About 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride
2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride (PubChem CID 136934360) has the molecular formula C12H12ClN5O2
and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride |
| PubChem CID | 136934360 |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride |
| SMILES | Cl.Nc1nc2nc(OCc3ccccc3)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H11N5O2.ClH/c13-11-15-9-8(10(18)17-11)14-12(16-9)19-6-7-4-2-1-3-5-7;/h1-5H,6H2,(H4,13,14,15,16,17,18);1H |
| InChIKey | LLTRRTMBMZATPK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride?
The IUPAC name of 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride (CID 136934360) is 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride.
What is the SMILES notation for 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride?
The canonical SMILES for 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride is Cl.Nc1nc2nc(OCc3ccccc3)[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride?
The InChIKey is LLTRRTMBMZATPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O2.ClH/c13-11-15-9-8(10(18)17-11)14-12(16-9)19-6-7-4-2-1-3-5-7;/h1-5H,6H2,(H4,13,14,15,16,17,18);1H.
What are the key properties of 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride?
2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride has a molecular weight of 293.71 g/mol, XLogP of 1.23, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-phenylmethoxy-1,7-dihydropurin-6-one;hydrochloride is sourced from PubChem (CID 136934360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).