About tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate
tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate (PubChem CID 136934852) has the molecular formula C16H17N3O5
and a molecular weight of 331.33 g/mol. Its IUPAC name is tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate |
| PubChem CID | 136934852 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate |
| SMILES | CC(C)(C)OC(=O)/N=N/C(=O)c1ccc(-n2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C16H17N3O5/c1-16(2,3)24-15(23)18-17-14(22)10-4-6-11(7-5-10)19-12(20)8-9-13(19)21/h4-9,20-21H,1-3H3/b18-17+ |
| InChIKey | UZDCIRCTZDHSSL-ISLYRVAYSA-N |
| XLogP | 3.42 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate?
The IUPAC name of tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate (CID 136934852) is tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate.
What is the SMILES notation for tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate?
The canonical SMILES for tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate is CC(C)(C)OC(=O)/N=N/C(=O)c1ccc(-n2c(O)ccc2O)cc1.
What is the InChIKey of tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate?
The InChIKey is UZDCIRCTZDHSSL-ISLYRVAYSA-N. The full InChI is InChI=1S/C16H17N3O5/c1-16(2,3)24-15(23)18-17-14(22)10-4-6-11(7-5-10)19-12(20)8-9-13(19)21/h4-9,20-21H,1-3H3/b18-17+.
What are the key properties of tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate?
tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate has a molecular weight of 331.33 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(2,5-dihydroxypyrrol-1-yl)benzoyl]iminocarbamate is sourced from PubChem (CID 136934852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).