C20H20ClN3O4 — CID 136935245
3-chloro-5-ethoxy-N-ethyl-4-hydroxy-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide (PubChem CID 136935245) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-N-ethyl-4-hydroxy-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide.
| Compound Name | 3-chloro-5-ethoxy-N-ethyl-4-hydroxy-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 136935245 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-chloro-5-ethoxy-N-ethyl-4-hydroxy-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)N(CC)Cc2nc3ccccc3c(=O)[nH]2)cc(Cl)c1O |
| InChI | InChI=1S/C20H20ClN3O4/c1-3-24(11-17-22-15-8-6-5-7-13(15)19(26)23-17)20(27)12-9-14(21)18(25)16(10-12)28-4-2/h5-10,25H,3-4,11H2,1-2H3,(H,22,23,26) |
| InChIKey | WTKCDWGUDAWGPL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |