About 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one
4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one (PubChem CID 136938489) has the molecular formula C10H17N3O4
and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one |
| PubChem CID | 136938489 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(NC(CO)(CO)CO)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H17N3O4/c1-2-7-11-8(3-9(17)12-7)13-10(4-14,5-15)6-16/h3,14-16H,2,4-6H2,1H3,(H2,11,12,13,17) |
| InChIKey | AVHPHYSCGWPIBK-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one?
The IUPAC name of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one (CID 136938489) is 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one?
The canonical SMILES for 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one is CCc1nc(NC(CO)(CO)CO)cc(=O)[nH]1.
What is the InChIKey of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one?
The InChIKey is AVHPHYSCGWPIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4/c1-2-7-11-8(3-9(17)12-7)13-10(4-14,5-15)6-16/h3,14-16H,2,4-6H2,1H3,(H2,11,12,13,17).
What are the key properties of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one?
4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one has a molecular weight of 243.26 g/mol, XLogP of -1.54, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-ethyl-1H-pyrimidin-6-one is sourced from PubChem (CID 136938489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).