C21H28N4OS — CID 136938802
3-hexylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one (PubChem CID 136938802) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 3-hexylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one.
| Compound Name | 3-hexylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 136938802 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-hexylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one |
| SMILES | CCCCCCSC1=NN2C(=c3ccccc3=NC23CCCCC3)C(=O)N1 |
| InChI | InChI=1S/C21H28N4OS/c1-2-3-4-10-15-27-20-22-19(26)18-16-11-6-7-12-17(16)23-21(25(18)24-20)13-8-5-9-14-21/h6-7,11-12H,2-5,8-10,13-15H2,1H3,(H,22,24,26) |
| InChIKey | UKTGQKMJMQPGIE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|