C18H24N4OS — CID 136938819
3-hexylsulfanyl-6,6-dimethyl-2H-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136938819) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-hexylsulfanyl-6,6-dimethyl-2H-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 3-hexylsulfanyl-6,6-dimethyl-2H-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136938819 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-hexylsulfanyl-6,6-dimethyl-2H-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCSC1=NN2C(=c3ccccc3=NC2(C)C)C(=O)N1 |
| InChI | InChI=1S/C18H24N4OS/c1-4-5-6-9-12-24-17-19-16(23)15-13-10-7-8-11-14(13)20-18(2,3)22(15)21-17/h7-8,10-11H,4-6,9,12H2,1-3H3,(H,19,21,23) |
| InChIKey | UWLBGDDEBLWKPP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|