C23H30N4OS — CID 136938870
3-hexylsulfanyl-6-(4-methylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136938870) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is 3-hexylsulfanyl-6-(4-methylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 3-hexylsulfanyl-6-(4-methylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136938870 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-hexylsulfanyl-6-(4-methylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCSC1=NN2C(=c3ccccc3=NC2C2CC=C(C)CC2)C(=O)N1 |
| InChI | InChI=1S/C23H30N4OS/c1-3-4-5-8-15-29-23-25-22(28)20-18-9-6-7-10-19(18)24-21(27(20)26-23)17-13-11-16(2)12-14-17/h6-7,9-11,17,21H,3-5,8,12-15H2,1-2H3,(H,25,26,28) |
| InChIKey | PTRZFOXZUZBOGZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|