C24H32N4OS — CID 136938871
6-(4,6-dimethylcyclohex-3-en-1-yl)-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136938871) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is 6-(4,6-dimethylcyclohex-3-en-1-yl)-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-(4,6-dimethylcyclohex-3-en-1-yl)-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136938871 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 6-(4,6-dimethylcyclohex-3-en-1-yl)-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCSC1=NN2C(=c3ccccc3=NC2C2CC=C(C)CC2C)C(=O)N1 |
| InChI | InChI=1S/C24H32N4OS/c1-4-5-6-9-14-30-24-26-23(29)21-19-10-7-8-11-20(19)25-22(28(21)27-24)18-13-12-16(2)15-17(18)3/h7-8,10-12,17-18,22H,4-6,9,13-15H2,1-3H3,(H,26,27,29) |
| InChIKey | BTFMGSOQUKHFIF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|