C30H31ClN4O3S — CID 136939052
6-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136939052) has the molecular formula C30H31ClN4O3S and a molecular weight of 563.12 g/mol. Its IUPAC name is 6-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136939052 |
| Molecular Formula | C30H31ClN4O3S |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 6-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCSC1=NN2C(=c3ccccc3=NC2c2cc(Cl)c(OCc3ccccc3)c(OCC)c2)C(=O)N1 |
| InChI | InChI=1S/C30H31ClN4O3S/c1-3-5-11-16-39-30-33-29(36)26-22-14-9-10-15-24(22)32-28(35(26)34-30)21-17-23(31)27(25(18-21)37-4-2)38-19-20-12-7-6-8-13-20/h6-10,12-15,17-18,28H,3-5,11,16,19H2,1-2H3,(H,33,34,36) |
| InChIKey | CLZKXRHLHNJWGH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|