C20H20N4OS — CID 136939113
3-methylsulfanyl-6-(2,4,6-trimethylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136939113) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-methylsulfanyl-6-(2,4,6-trimethylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 3-methylsulfanyl-6-(2,4,6-trimethylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136939113 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3-methylsulfanyl-6-(2,4,6-trimethylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CSC1=NN2C(=c3ccccc3=NC2c2c(C)cc(C)cc2C)C(=O)N1 |
| InChI | InChI=1S/C20H20N4OS/c1-11-9-12(2)16(13(3)10-11)18-21-15-8-6-5-7-14(15)17-19(25)22-20(26-4)23-24(17)18/h5-10,18H,1-4H3,(H,22,23,25) |
| InChIKey | SBNCBUCVLKNFMM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |