C18H20N4OS — CID 136939201
3-prop-2-enylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one (PubChem CID 136939201) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-prop-2-enylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one.
| Compound Name | 3-prop-2-enylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 136939201 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-prop-2-enylsulfanylspiro[2H-[1,2,4]triazino[1,6-c]quinazoline-6,1'-cyclohexane]-1-one |
| SMILES | C=CCSC1=NN2C(=c3ccccc3=NC23CCCCC3)C(=O)N1 |
| InChI | InChI=1S/C18H20N4OS/c1-2-12-24-17-19-16(23)15-13-8-4-5-9-14(13)20-18(22(15)21-17)10-6-3-7-11-18/h2,4-5,8-9H,1,3,6-7,10-12H2,(H,19,21,23) |
| InChIKey | BLBWYFGAVDGRNO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|