C22H27BrN4OS — CID 136939315
10-bromo-3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136939315) has the molecular formula C22H27BrN4OS and a molecular weight of 475.46 g/mol. Its IUPAC name is 10-bromo-3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 10-bromo-3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136939315 |
| Molecular Formula | C22H27BrN4OS |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 10-bromo-3-butylsulfanyl-6-(4,6-dimethylcyclohex-3-en-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3cc(Br)ccc3=NC2C2CC=C(C)CC2C)C(=O)N1 |
| InChI | InChI=1S/C22H27BrN4OS/c1-4-5-10-29-22-25-21(28)19-17-12-15(23)7-9-18(17)24-20(27(19)26-22)16-8-6-13(2)11-14(16)3/h6-7,9,12,14,16,20H,4-5,8,10-11H2,1-3H3,(H,25,26,28) |
| InChIKey | SSFNEJQPJWTUFF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|