C20H18BrN5O4S — CID 136939323
10-bromo-3-butylsulfanyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136939323) has the molecular formula C20H18BrN5O4S and a molecular weight of 504.37 g/mol. Its IUPAC name is 10-bromo-3-butylsulfanyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 10-bromo-3-butylsulfanyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136939323 |
| Molecular Formula | C20H18BrN5O4S |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 10-bromo-3-butylsulfanyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3cc(Br)ccc3=NC2/C=C/c2ccc([N+](=O)[O-])o2)C(=O)N1 |
| InChI | InChI=1S/C20H18BrN5O4S/c1-2-3-10-31-20-23-19(27)18-14-11-12(21)4-7-15(14)22-16(25(18)24-20)8-5-13-6-9-17(30-13)26(28)29/h4-9,11,16H,2-3,10H2,1H3,(H,23,24,27)/b8-5+ |
| InChIKey | GYBCDWGOANUAPZ-VMPITWQZSA-N |
| XLogP | 2.97 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|