C25H31BrN4OS — CID 136939404
10-bromo-3-ethylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136939404) has the molecular formula C25H31BrN4OS and a molecular weight of 515.52 g/mol. Its IUPAC name is 10-bromo-3-ethylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 10-bromo-3-ethylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136939404 |
| Molecular Formula | C25H31BrN4OS |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 10-bromo-3-ethylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCSC1=NN2C(=c3cc(Br)ccc3=NC2C2CC3C(=CCCC3(C)C)CC2C)C(=O)N1 |
| InChI | InChI=1S/C25H31BrN4OS/c1-5-32-24-28-23(31)21-18-12-16(26)8-9-20(18)27-22(30(21)29-24)17-13-19-15(11-14(17)2)7-6-10-25(19,3)4/h7-9,12,14,17,19,22H,5-6,10-11,13H2,1-4H3,(H,28,29,31) |
| InChIKey | COWBAFGLVDHNRL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|