C21H19BrN4O3S — CID 136939741
6-(6-bromo-1,3-benzodioxol-5-yl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136939741) has the molecular formula C21H19BrN4O3S and a molecular weight of 487.38 g/mol. Its IUPAC name is 6-(6-bromo-1,3-benzodioxol-5-yl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-(6-bromo-1,3-benzodioxol-5-yl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136939741 |
| Molecular Formula | C21H19BrN4O3S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 6-(6-bromo-1,3-benzodioxol-5-yl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=NC2c2cc3c(cc2Br)OCO3)C(=O)N1 |
| InChI | InChI=1S/C21H19BrN4O3S/c1-2-3-8-30-21-24-20(27)18-12-6-4-5-7-15(12)23-19(26(18)25-21)13-9-16-17(10-14(13)22)29-11-28-16/h4-7,9-10,19H,2-3,8,11H2,1H3,(H,24,25,27) |
| InChIKey | SOINKGXYYSHPSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|