C24H25BrN4O4S — CID 136940085
2-[4-(10-bromo-3-hexylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenoxy]acetic acid (PubChem CID 136940085) has the molecular formula C24H25BrN4O4S and a molecular weight of 545.46 g/mol. Its IUPAC name is 2-[4-(10-bromo-3-hexylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-(10-bromo-3-hexylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 136940085 |
| Molecular Formula | C24H25BrN4O4S |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | 2-[4-(10-bromo-3-hexylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenoxy]acetic acid |
| SMILES | CCCCCCSC1=NN2C(=c3cc(Br)ccc3=NC2c2ccc(OCC(=O)O)cc2)C(=O)N1 |
| InChI | InChI=1S/C24H25BrN4O4S/c1-2-3-4-5-12-34-24-27-23(32)21-18-13-16(25)8-11-19(18)26-22(29(21)28-24)15-6-9-17(10-7-15)33-14-20(30)31/h6-11,13,22H,2-5,12,14H2,1H3,(H,30,31)(H,27,28,32) |
| InChIKey | PCKYPVGEFDQYBF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|