C21H19N5O4S — CID 136940185
6-(2-ethoxy-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136940185) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 6-(2-ethoxy-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-(2-ethoxy-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136940185 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 6-(2-ethoxy-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2C(=c3ccccc3=NC2c2cc([N+](=O)[O-])ccc2OCC)C(=O)N1 |
| InChI | InChI=1S/C21H19N5O4S/c1-3-11-31-21-23-20(27)18-14-7-5-6-8-16(14)22-19(25(18)24-21)15-12-13(26(28)29)9-10-17(15)30-4-2/h3,5-10,12,19H,1,4,11H2,2H3,(H,23,24,27) |
| InChIKey | GWSRXRZEBFVURI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|