C24H17BrN4O3S — CID 136940631
[4-(3-methylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenyl] 4-bromobenzoate (PubChem CID 136940631) has the molecular formula C24H17BrN4O3S and a molecular weight of 521.40 g/mol. Its IUPAC name is [4-(3-methylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenyl] 4-bromobenzoate.
| Compound Name | [4-(3-methylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 136940631 |
| Molecular Formula | C24H17BrN4O3S |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | [4-(3-methylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-6-yl)phenyl] 4-bromobenzoate |
| SMILES | CSC1=NN2C(=c3ccccc3=NC2c2ccc(OC(=O)c3ccc(Br)cc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C24H17BrN4O3S/c1-33-24-27-22(30)20-18-4-2-3-5-19(18)26-21(29(20)28-24)14-8-12-17(13-9-14)32-23(31)15-6-10-16(25)11-7-15/h2-13,21H,1H3,(H,27,28,30) |
| InChIKey | IGCJPZVMAXZEMI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|