C23H18ClN4O2S+ — CID 136940653
7-acetyl-10-chloro-3-methylsulfanyl-6-naphthalen-1-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940653) has the molecular formula C23H18ClN4O2S+ and a molecular weight of 449.94 g/mol. Its IUPAC name is 7-acetyl-10-chloro-3-methylsulfanyl-6-naphthalen-1-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-acetyl-10-chloro-3-methylsulfanyl-6-naphthalen-1-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940653 |
| Molecular Formula | C23H18ClN4O2S+ |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 7-acetyl-10-chloro-3-methylsulfanyl-6-naphthalen-1-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CSc1n[n+]2c(c(=O)[nH]1)-c1cc(Cl)ccc1N(C(C)=O)C2c1cccc2ccccc12 |
| InChI | InChI=1S/C23H17ClN4O2S/c1-13(29)27-19-11-10-15(24)12-18(19)20-21(30)25-23(31-2)26-28(20)22(27)17-9-5-7-14-6-3-4-8-16(14)17/h3-12,22H,1-2H3/p+1 |
| InChIKey | QUQKVFOEHBRUHK-UHFFFAOYSA-O |
| XLogP | 4.17 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|