C25H31N5OS — CID 136940711
6-[4-(dimethylamino)phenyl]-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136940711) has the molecular formula C25H31N5OS and a molecular weight of 449.62 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-[4-(dimethylamino)phenyl]-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136940711 |
| Molecular Formula | C25H31N5OS |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCCSC1=NN2C(=c3ccccc3=NC2c2ccc(N(C)C)cc2)C(=O)N1 |
| InChI | InChI=1S/C25H31N5OS/c1-4-5-6-7-10-17-32-25-27-24(31)22-20-11-8-9-12-21(20)26-23(30(22)28-25)18-13-15-19(16-14-18)29(2)3/h8-9,11-16,23H,4-7,10,17H2,1-3H3,(H,27,28,31) |
| InChIKey | JUSAWCXKWZITGW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|