C22H24N4O4S — CID 136940717
3-propylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136940717) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 3-propylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 3-propylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136940717 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-propylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCSC1=NN2C(=c3ccccc3=NC2c2c(OC)cc(OC)cc2OC)C(=O)N1 |
| InChI | InChI=1S/C22H24N4O4S/c1-5-10-31-22-24-21(27)19-14-8-6-7-9-15(14)23-20(26(19)25-22)18-16(29-3)11-13(28-2)12-17(18)30-4/h6-9,11-12,20H,5,10H2,1-4H3,(H,24,25,27) |
| InChIKey | CXAKTLZIKKLWRX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |