C20H21BrN4OS2 — CID 136940776
10-bromo-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136940776) has the molecular formula C20H21BrN4OS2 and a molecular weight of 477.45 g/mol. Its IUPAC name is 10-bromo-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 10-bromo-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136940776 |
| Molecular Formula | C20H21BrN4OS2 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 10-bromo-6-(5-methylthiophen-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCSC1=NN2C(=c3cc(Br)ccc3=NC2c2ccc(C)s2)C(=O)N1 |
| InChI | InChI=1S/C20H21BrN4OS2/c1-3-4-5-10-27-20-23-19(26)17-14-11-13(21)7-8-15(14)22-18(25(17)24-20)16-9-6-12(2)28-16/h6-9,11,18H,3-5,10H2,1-2H3,(H,23,24,26) |
| InChIKey | ONKKVCYZPNNTRL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|