C22H23BrN4O3S — CID 136940905
6-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136940905) has the molecular formula C22H23BrN4O3S and a molecular weight of 503.42 g/mol. Its IUPAC name is 6-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136940905 |
| Molecular Formula | C22H23BrN4O3S |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 6-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=NC2c2cc(Br)c(O)c(OCC)c2)C(=O)N1 |
| InChI | InChI=1S/C22H23BrN4O3S/c1-3-5-10-31-22-25-21(29)18-14-8-6-7-9-16(14)24-20(27(18)26-22)13-11-15(23)19(28)17(12-13)30-4-2/h6-9,11-12,20,28H,3-5,10H2,1-2H3,(H,25,26,29) |
| InChIKey | IXOBJDGEFVZSFV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|