C9H10F3N3O — CID 136941200
2-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 136941200) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136941200 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CC(F)(F)F)nc2c1CNCC2 |
| InChI | InChI=1S/C9H10F3N3O/c10-9(11,12)3-7-14-6-1-2-13-4-5(6)8(16)15-7/h13H,1-4H2,(H,14,15,16) |
| InChIKey | AXTJCLOHWMNIPG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |