C8H8F3N3O — CID 136941432
2-(2,2,2-trifluoroethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 136941432) has the molecular formula C8H8F3N3O and a molecular weight of 219.17 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,2-trifluoroethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136941432 |
| Molecular Formula | C8H8F3N3O |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CC(F)(F)F)nc2c1CNC2 |
| InChI | InChI=1S/C8H8F3N3O/c9-8(10,11)1-6-13-5-3-12-2-4(5)7(15)14-6/h12H,1-3H2,(H,13,14,15) |
| InChIKey | PEADOBLRGXULSS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |