C10H15BrN2O3S — CID 136941717
5-bromo-2-(1-methylsulfonylethyl)-4-propyl-1H-pyrimidin-6-one (PubChem CID 136941717) has the molecular formula C10H15BrN2O3S and a molecular weight of 323.21 g/mol. Its IUPAC name is 5-bromo-2-(1-methylsulfonylethyl)-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-(1-methylsulfonylethyl)-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136941717 |
| Molecular Formula | C10H15BrN2O3S |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 5-bromo-2-(1-methylsulfonylethyl)-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1nc(C(C)S(C)(=O)=O)[nH]c(=O)c1Br |
| InChI | InChI=1S/C10H15BrN2O3S/c1-4-5-7-8(11)10(14)13-9(12-7)6(2)17(3,15)16/h6H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | JGAJAXWLDYVFBQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |