C12H20N2O3S — CID 136941789
N-cyclopentyl-1,1-dioxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,4,3]oxathiazin-3-imine (PubChem CID 136941789) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-cyclopentyl-1,1-dioxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,4,3]oxathiazin-3-imine.
| Compound Name | N-cyclopentyl-1,1-dioxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,4,3]oxathiazin-3-imine |
|---|---|
| PubChem CID | 136941789 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-cyclopentyl-1,1-dioxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,4,3]oxathiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N/C2CCCC2)OC2CCCCC21 |
| InChI | InChI=1S/C12H20N2O3S/c15-18(16)11-8-4-3-7-10(11)17-12(14-18)13-9-5-1-2-6-9/h9-11H,1-8H2,(H,13,14) |
| InChIKey | UUDODEZLLNVTQW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|