About (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine
(NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine (PubChem CID 136948288) has the molecular formula C8H6N2OS
and a molecular weight of 178.22 g/mol. Its IUPAC name is (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine |
| PubChem CID | 136948288 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine |
| SMILES | O/N=C/c1nsc2ccccc12 |
| InChI | InChI=1S/C8H6N2OS/c11-9-5-7-6-3-1-2-4-8(6)12-10-7/h1-5,11H/b9-5+ |
| InChIKey | UYRQFGQVPMBCNC-WEVVVXLNSA-N |
| XLogP | 2.10 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine?
The IUPAC name of (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine (CID 136948288) is (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine.
What is the SMILES notation for (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine?
The canonical SMILES for (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine is O/N=C/c1nsc2ccccc12.
What is the InChIKey of (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine?
The InChIKey is UYRQFGQVPMBCNC-WEVVVXLNSA-N. The full InChI is InChI=1S/C8H6N2OS/c11-9-5-7-6-3-1-2-4-8(6)12-10-7/h1-5,11H/b9-5+.
What are the key properties of (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine?
(NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine has a molecular weight of 178.22 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(1,2-benzothiazol-3-ylmethylidene)hydroxylamine is sourced from PubChem (CID 136948288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).