About 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide
2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide (PubChem CID 136948314) has the molecular formula C6H9BrN2OS
and a molecular weight of 237.12 g/mol. Its IUPAC name is 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide.
Molecular Properties
| Compound Name | 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide |
| PubChem CID | 136948314 |
| Molecular Formula | C6H9BrN2OS |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide |
| SMILES | Br.C=CC/N=C1/NC(=O)CS1 |
| InChI | InChI=1S/C6H8N2OS.BrH/c1-2-3-7-6-8-5(9)4-10-6;/h2H,1,3-4H2,(H,7,8,9);1H |
| InChIKey | ZTCVGVQGNXSMQJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide?
The IUPAC name of 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide (CID 136948314) is 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide.
What is the SMILES notation for 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide?
The canonical SMILES for 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide is Br.C=CC/N=C1/NC(=O)CS1.
What is the InChIKey of 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide?
The InChIKey is ZTCVGVQGNXSMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS.BrH/c1-2-3-7-6-8-5(9)4-10-6;/h2H,1,3-4H2,(H,7,8,9);1H.
What are the key properties of 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide?
2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide has a molecular weight of 237.12 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylimino-1,3-thiazolidin-4-one;hydrobromide is sourced from PubChem (CID 136948314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).