C10H12F3N3O2 — CID 136949005
4-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136949005) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 4-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136949005 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N2CCC(O)(C(F)(F)F)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H12F3N3O2/c1-6-14-7(4-8(17)15-6)16-3-2-9(18,5-16)10(11,12)13/h4,18H,2-3,5H2,1H3,(H,14,15,17) |
| InChIKey | OOMCXTRGRVHSDH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |