About 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol
2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol (PubChem CID 136949098) has the molecular formula C25H18FN3OS
and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol |
| PubChem CID | 136949098 |
| Molecular Formula | C25H18FN3OS |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol |
| SMILES | Oc1c(/C=c2\ccc3c(c2)C=CN=3)s/c(=N\Cc2ccc(F)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H18FN3OS/c26-20-9-6-17(7-10-20)16-28-25-29(21-4-2-1-3-5-21)24(30)23(31-25)15-18-8-11-22-19(14-18)12-13-27-22/h1-15,30H,16H2/b18-15+,28-25- |
| InChIKey | MZYFVNYZZSASEO-GYPSLGRWSA-N |
| XLogP | 3.92 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol?
The IUPAC name of 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol (CID 136949098) is 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol.
What is the SMILES notation for 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol?
The canonical SMILES for 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol is Oc1c(/C=c2\ccc3c(c2)C=CN=3)s/c(=N\Cc2ccc(F)cc2)n1-c1ccccc1.
What is the InChIKey of 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol?
The InChIKey is MZYFVNYZZSASEO-GYPSLGRWSA-N. The full InChI is InChI=1S/C25H18FN3OS/c26-20-9-6-17(7-10-20)16-28-25-29(21-4-2-1-3-5-21)24(30)23(31-25)15-18-8-11-22-19(14-18)12-13-27-22/h1-15,30H,16H2/b18-15+,28-25-.
What are the key properties of 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol?
2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol has a molecular weight of 427.50 g/mol, XLogP of 3.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)methylimino]-5-[(E)-indol-5-ylidenemethyl]-3-phenyl-1,3-thiazol-4-ol is sourced from PubChem (CID 136949098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).