C15H17N5S — CID 136949301
2-[3-(2,4-dimethylphenyl)-1,2,4,6-tetrazabicyclo[3.2.0]hepta-2,4-dien-7-yl]-1,3-thiazole;methane (PubChem CID 136949301) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[3-(2,4-dimethylphenyl)-1,2,4,6-tetrazabicyclo[3.2.0]hepta-2,4-dien-7-yl]-1,3-thiazole;methane.
| Compound Name | 2-[3-(2,4-dimethylphenyl)-1,2,4,6-tetrazabicyclo[3.2.0]hepta-2,4-dien-7-yl]-1,3-thiazole;methane |
|---|---|
| PubChem CID | 136949301 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[3-(2,4-dimethylphenyl)-1,2,4,6-tetrazabicyclo[3.2.0]hepta-2,4-dien-7-yl]-1,3-thiazole;methane |
| SMILES | C.Cc1ccc(-c2nc3n(n2)C(c2nccs2)N3)c(C)c1 |
| InChI | InChI=1S/C14H13N5S.CH4/c1-8-3-4-10(9(2)7-8)11-16-14-17-12(19(14)18-11)13-15-5-6-20-13;/h3-7,12H,1-2H3,(H,16,17,18);1H4 |
| InChIKey | YAYPCWZAHZQYKB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |