C29H20ClN3O5S — CID 136949493
phenyl 5-chloro-2-[1-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]sulfinyl-2,3-dihydroindol-5-yl]benzoate (PubChem CID 136949493) has the molecular formula C29H20ClN3O5S and a molecular weight of 558.02 g/mol. Its IUPAC name is phenyl 5-chloro-2-[1-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]sulfinyl-2,3-dihydroindol-5-yl]benzoate.
| Compound Name | phenyl 5-chloro-2-[1-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]sulfinyl-2,3-dihydroindol-5-yl]benzoate |
|---|---|
| PubChem CID | 136949493 |
| Molecular Formula | C29H20ClN3O5S |
| Molecular Weight | 558.02 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | phenyl 5-chloro-2-[1-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]sulfinyl-2,3-dihydroindol-5-yl]benzoate |
| SMILES | O=C(Oc1ccccc1)c1cc(Cl)ccc1-c1ccc2c(c1)CCN2S(=O)c1ccc(-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C29H20ClN3O5S/c30-21-9-12-24(25(17-21)28(34)37-22-4-2-1-3-5-22)19-8-13-26-20(16-19)14-15-33(26)39(36)23-10-6-18(7-11-23)27-31-29(35)38-32-27/h1-13,16-17H,14-15H2,(H,31,32,35) |
| InChIKey | RBOBJIPSOAXKAO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.02 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|